Difference between revisions of "Heparan-sulfate-L-IdoA-2S"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * inchi key: ** InChIKey=HCJMNOSI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17861 RXN-17861] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17861 RXN-17861] ==
−
* smiles:
+
* direction:
−
** CC1(C(=C(C=CC=1)O)C([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/2.3.1.bu EC-2.3.1.bu]
−
* common name:
+
−
** 6-methylsalicylate
+
−
* molecular weight:
+
−
** 151.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Methylsalicylic acid
 
−
** 6-Methyl 2-hydroxybenzenecarboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2.3.1.165-RXN]]
+
** 1 [[ACETYL-COA]][c] '''+''' 1 [[N-terminal-L-cysteine]][c] '''=>''' 1 [[N-terminal-N-Ac-L-cysteine]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CO-A]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 acetyl-CoA[c] '''+''' 1 an N-terminal L-cysteinyl-[protein][c] '''=>''' 1 an N-terminal Nα-acetyl-L-cysteinyl-[protein][c] '''+''' 1 H+[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536]
+
{{#set: ec number=EC-2.3.1.bu}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7800}}
−
** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658]
+
{{#set: reconstruction tool=pathwaytools}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657]
+
−
{{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}}
+
−
{{#set: common name=6-methylsalicylate}}
+
−
{{#set: molecular weight=151.141    }}
+
−
{{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}}
+
−
{{#set: produced by=2.3.1.165-RXN}}
+

Revision as of 15:54, 21 March 2018

Reaction RXN-17861

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7800, Ac/N-end rule pathway: PWY-7800
    • 21 reactions found over 21 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Heparan-sulfate-L-IdoA-2S&oldid=37222"