Difference between revisions of "CPD-881"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-D-serines Protein-D-serines] == * common name: ** a [protein]-D-serine * Synonym(s): =...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-715 CPD-715] == |
+ | * smiles: | ||
+ | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) | ||
* common name: | * common name: | ||
− | ** | + | ** 6-deoxoteasterone |
+ | * inchi key: | ||
+ | ** InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N | ||
+ | * molecular weight: | ||
+ | ** 434.701 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxoteasterone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-775]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-774]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * LIPID_MAPS : LMST01030120 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11144580 11144580] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20716 20716] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15799 C15799] | ||
+ | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=6-deoxoteasterone}} | ||
+ | {{#set: inchi key=InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N}} | ||
+ | {{#set: molecular weight=434.701 }} | ||
+ | {{#set: common name=deoxoteasterone}} | ||
+ | {{#set: consumed by=RXN-775}} | ||
+ | {{#set: produced by=RXN-774}} |
Revision as of 15:54, 21 March 2018
Contents
Metabolite CPD-715
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 6-deoxoteasterone
- inchi key:
- InChIKey=WPHVOXMMNSLJSF-GUOPQYDVSA-N
- molecular weight:
- 434.701
- Synonym(s):
- deoxoteasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.