Difference between revisions of "L-glutamyl-tRNAGln"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * co...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-methylumbelliferyl glucoside |
+ | * inchi key: | ||
+ | ** InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 338.313 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-MU-glucoside |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10769]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
+ | * DRUGBANK : DB02639 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=2733779 2733779] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2015550.html 2015550] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=91117 91117] |
− | + | {{#set: smiles=CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))}} | |
− | + | {{#set: common name=4-methylumbelliferyl glucoside}} | |
− | + | {{#set: inchi key=InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N}} | |
− | {{#set: smiles= | + | {{#set: molecular weight=338.313 }} |
− | {{#set: | + | {{#set: common name=4-MU-glucoside}} |
− | {{#set: | + | {{#set: consumed by=RXN-10769}} |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 16:54, 21 March 2018
Contents
Metabolite CPD-11641
- smiles:
- CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3))
- common name:
- 4-methylumbelliferyl glucoside
- inchi key:
- InChIKey=YUDPTGPSBJVHCN-YMILTQATSA-N
- molecular weight:
- 338.313
- Synonym(s):
- 4-MU-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links