Difference between revisions of "Uracil-54-in-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == |
* smiles: | * smiles: | ||
− | ** C([O-])(=O) | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phytyl monophosphate |
+ | * inchi key: | ||
+ | ** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 374.499 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phytolmonophosphate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7683]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] |
− | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} | |
− | + | {{#set: common name=phytyl monophosphate}} | |
− | {{#set: smiles=C([O-])(=O) | + | {{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}} |
− | {{#set: | + | {{#set: molecular weight=374.499 }} |
− | {{#set: | + | {{#set: common name=phytolmonophosphate}} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-7683}} |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 15:55, 21 March 2018
Contents
Metabolite CPD-7025
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
- common name:
- phytyl monophosphate
- inchi key:
- InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
- molecular weight:
- 374.499
- Synonym(s):
- phytolmonophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.