Difference between revisions of "N-Acetyl-beta-D-Hexosaminides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATUD ATUD] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:UDP phosphotransferase * Synonym(...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATUD ATUD] ==
−
* smiles:
+
* direction:
−
** C[S+](CCC([N+])C(=O)[O-])C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
+
 
* common name:
 
* common name:
−
** S-methyl-L-methionine
+
** ATP:UDP phosphotransferase
−
* molecular weight:
+
−
** 164.242   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-methylmethionine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MMUM-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[UDP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[UTP]][c] '''+''' 1.0 [[ADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 UDP[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 UTP[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13128]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_16529]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
+
{{#set: common name=ATP:UDP phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_13128|Tiso_gene_16529}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
+
{{#set: in pathway=}}
−
* BIGG : mmet
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
+
−
{{#set: common name=S-methyl-L-methionine}}
+
−
{{#set: molecular weight=164.242    }}
+
−
{{#set: common name=S-methylmethionine}}
+
−
{{#set: consumed by=MMUM-RXN}}
+

Revision as of 15:55, 21 March 2018

Reaction ATUD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:UDP phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 UDP[c] + 1.0 ATP[c] => 1.0 UTP[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Acetyl-beta-D-Hexosaminides&oldid=37296"