Difference between revisions of "Tiso gene 14816"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10862 RXN-10862] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10862 RXN-10862] ==
−
* smiles:
+
* direction:
−
** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
+
 
* common name:
 
* common name:
−
** GDP-β-L-gulose
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 603.329   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[ADP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c]
−
* [[RXN-7772]]
+
* With common name(s):
−
* [[RXN-7771]]
+
** 1 ADP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00122 R00122]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925]
+
{{#set: common name=ORF}}
−
{{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}}
+
{{#set: ec number=EC-3.6.1.5}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}}
+
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
−
{{#set: common name=GDP-β-L-gulose}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=603.329    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: reversible reaction associated=RXN-7772|RXN-7771}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 15:55, 21 March 2018

Reaction RXN-10862

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ADP[c] + 1 H2O[c] => 1 phosphate[c] + 1 H+[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14816&oldid=37337"