Difference between revisions of "RXN-8032"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] == * smiles: ** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] == * direction: ** LEFT-TO-RIGHT * common name: ** 2'-Deoxyguanosine 5'-triphosphate dip...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] ==
−
* smiles:
+
* direction:
−
** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J
+
 
* common name:
 
* common name:
−
** choloyl-CoA
+
** 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
−
* molecular weight:
+
−
** 1154.064   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA
 
−
** 3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2.3.1.176-RXN]]
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[DGTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DGMP]][c] '''+''' 1.0 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 dGTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 dGMP[c] '''+''' 1.0 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266600 45266600]
+
{{#set: common name=2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18793}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57373 57373]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01794 C01794]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB01374
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))}}
+
−
{{#set: inchi key=InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J}}
+
−
{{#set: common name=choloyl-CoA}}
+
−
{{#set: molecular weight=1154.064    }}
+
−
{{#set: common name=3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA}}
+
−
{{#set: produced by=2.3.1.176-RXN}}
+

Revision as of 15:55, 21 March 2018

Reaction DGTD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 dGTP[c] => 1.0 H+[c] + 1.0 dGMP[c] + 1.0 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8032&oldid=37350"