Difference between revisions of "Cis-cis-D15-27-C46-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13699 CPD-13699] == * smiles: ** CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] == * common name: ** an N-modified amino a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13699 CPD-13699] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Substituted-Amino-Acids N-Substituted-Amino-Acids] ==
* smiles:
+
** CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
* inchi key:
+
** InChIKey=MUOUYOUSQGFFIP-GDRSPGQTSA-J
+
 
* common name:
 
* common name:
** 3,22-dioxochol-4-en-24-oyl-CoA
+
** an N-modified amino acid
* molecular weight:
+
** 1132.017   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** an N-substituted amino acid
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12710]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AMINOCYL-TRNA-HYDROLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-modified amino acid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658756 90658756]
+
{{#set: common name=an N-substituted amino acid}}
* CHEBI:
+
{{#set: produced by=AMINOCYL-TRNA-HYDROLASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86014 86014]
+
{{#set: smiles=CC(C(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: inchi key=InChIKey=MUOUYOUSQGFFIP-GDRSPGQTSA-J}}
+
{{#set: common name=3,22-dioxochol-4-en-24-oyl-CoA}}
+
{{#set: molecular weight=1132.017    }}
+
{{#set: consumed by=RXN-12710}}
+

Revision as of 15:55, 21 March 2018

Metabolite N-Substituted-Amino-Acids

  • common name:
    • an N-modified amino acid
  • Synonym(s):
    • an N-substituted amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links