Difference between revisions of "PHOSPHORYL-CHOLINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-propeptides SUMO-propeptides] == * common name: ** a small ubiquitin-like modifier (SUMO)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUMO-propeptides SUMO-propeptides] ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M
+
 
* common name:
 
* common name:
** gibberellin A4
+
** a small ubiquitin-like modifier (SUMO) propeptide
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA4
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6550]]
+
* [[3.4.22.68-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-165]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB07815
+
{{#set: common name=a small ubiquitin-like modifier (SUMO) propeptide}}
* LIPID_MAPS : LMPR0104170021
+
{{#set: consumed by=3.4.22.68-RXN}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245706 25245706]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11864 C11864]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32902 32902]
+
* METABOLIGHTS : MTBLC32902
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M}}
+
{{#set: common name=gibberellin A4}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA4}}
+
{{#set: consumed by=RXN-6550}}
+
{{#set: produced by=RXN1F-165}}
+

Revision as of 15:55, 21 March 2018

Metabolite SUMO-propeptides

  • common name:
    • a small ubiquitin-like modifier (SUMO) propeptide
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links