Difference between revisions of "Tiso gene 20054"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMIDINE THYMIDINE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(CO)O2)) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OROPRIBTRANS-RXN OROPRIBTRANS-RXN] == * direction: ** REVERSIBLE * common name: ** orotate_phosphor...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OROPRIBTRANS-RXN OROPRIBTRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** orotate_phosphoribosyltransferase |
− | * | + | ** trna_(cytosine_-c_)-methyltransferase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.4.2.10 EC-2.4.2.10] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[PPI]][c] '''+''' 1 [[OROTIDINE-5-PHOSPHATE]][c] '''<=>''' 1 [[OROTATE]][c] '''+''' 1 [[PRPP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 diphosphate[c] '''+''' 1 orotidine 5'-phosphate[c] '''<=>''' 1 orotate[c] '''+''' 1 5-phospho-α-D-ribose 1-diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11163]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18647]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_11164]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7790]], UMP biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7790 PWY-7790] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7791]], UMP biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7791 PWY-7791] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-5686]], UMP biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10380 10380] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01870 R01870] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P08309 P08309] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P11172 P11172] |
− | * | + | ** [http://www.uniprot.org/uniprot/P18132 P18132] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P77889 P77889] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A5U0 P0A5U0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PIR1 Q9PIR1] |
− | * | + | ** [http://www.uniprot.org/uniprot/O67742 O67742] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O58855 O58855] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9Z7U6 Q9Z7U6] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9Y9D8 Q9Y9D8] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P56814 P56814] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q58509 Q58509] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O28533 O28533] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CGM8 Q9CGM8] |
+ | ** [http://www.uniprot.org/uniprot/P25972 P25972] | ||
+ | ** [http://www.uniprot.org/uniprot/O27888 O27888] | ||
+ | ** [http://www.uniprot.org/uniprot/P65915 P65915] | ||
+ | ** [http://www.uniprot.org/uniprot/P46534 P46534] | ||
+ | ** [http://www.uniprot.org/uniprot/P43855 P43855] | ||
+ | ** [http://www.uniprot.org/uniprot/P31754 P31754] | ||
+ | ** [http://www.uniprot.org/uniprot/P18904 P18904] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01637 Q01637] | ||
+ | ** [http://www.uniprot.org/uniprot/P09556 P09556] | ||
+ | ** [http://www.uniprot.org/uniprot/P21846 P21846] | ||
+ | ** [http://www.uniprot.org/uniprot/P35788 P35788] | ||
+ | ** [http://www.uniprot.org/uniprot/P08870 P08870] | ||
+ | ** [http://www.uniprot.org/uniprot/Q18516 Q18516] | ||
+ | ** [http://www.uniprot.org/uniprot/Q45918 Q45918] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42586 Q42586] | ||
+ | ** [http://www.uniprot.org/uniprot/P41923 P41923] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55574 Q55574] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42942 Q42942] | ||
+ | ** [http://www.uniprot.org/uniprot/O76139 O76139] | ||
+ | ** [http://www.uniprot.org/uniprot/O61790 O61790] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9X8R7 Q9X8R7] | ||
+ | ** [http://www.uniprot.org/uniprot/O94331 O94331] | ||
+ | ** [http://www.uniprot.org/uniprot/P30402 P30402] | ||
+ | ** [http://www.uniprot.org/uniprot/P13298 P13298] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A7E3 P0A7E3] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=orotate_phosphoribosyltransferase}} | ||
+ | {{#set: common name=trna_(cytosine_-c_)-methyltransferase}} | ||
+ | {{#set: ec number=EC-2.4.2.10}} | ||
+ | {{#set: gene associated=Tiso_gene_11163|Tiso_gene_18647|Tiso_gene_11164}} | ||
+ | {{#set: in pathway=PWY-7790|PWY-7791|PWY-5686}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 15:55, 21 March 2018
Contents
Reaction OROPRIBTRANS-RXN
- direction:
- REVERSIBLE
- common name:
- orotate_phosphoribosyltransferase
- trna_(cytosine_-c_)-methyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PPI[c] + 1 OROTIDINE-5-PHOSPHATE[c] <=> 1 OROTATE[c] + 1 PRPP[c]
- With common name(s):
- 1 diphosphate[c] + 1 orotidine 5'-phosphate[c] <=> 1 orotate[c] + 1 5-phospho-α-D-ribose 1-diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11163
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18647
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_11164
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7790, UMP biosynthesis II: PWY-7790
- 6 reactions found over 6 reactions in the full pathway
- PWY-7791, UMP biosynthesis III: PWY-7791
- 5 reactions found over 6 reactions in the full pathway
- PWY-5686, UMP biosynthesis I: PWY-5686
- 6 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: