Difference between revisions of "CPD-731"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...")
(Created page with "Category:Gene == Gene Tiso_gene_3113 == * Synonym(s): == Reactions associated == * Reaction: NADH-DEHYDROG-A-RXN ** Source: orthology-esiliculosus * Reaction: N...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+
== Gene Tiso_gene_3113 ==
* smiles:
+
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
+
* inchi key:
+
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
+
* common name:
+
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
+
* molecular weight:
+
** 262.262   
+
 
* Synonym(s):
 
* Synonym(s):
** salicyl-HCH
 
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 
** acylsaligenin
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12252]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[NADHor_2m]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
* CAS : 529507-98-0
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|NADHor_2m}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
+
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
+
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
+
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
+
{{#set: molecular weight=262.262    }}
+
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
+
{{#set: consumed by=RXN-12252}}
+

Revision as of 16:56, 21 March 2018

Gene Tiso_gene_3113

  • Synonym(s):

Reactions associated

Pathways associated

External links