Difference between revisions of "Tiso gene 3113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] == * smiles: ** CC(=O)C([N+])C([O-])=O * inchi key: ** InChIKey=SAUC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16631 RXN-16631] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16631 RXN-16631] ==
−
* smiles:
+
* direction:
−
** CC(=O)C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N
+
 
* common name:
 
* common name:
−
** L-2-amino-3-oxobutanoate
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
−
* molecular weight:
+
* ec number:
−
** 117.104   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxothreonine
 
−
** 3-keto-L-threonine
 
−
** L-2-amino-acetoacetate
 
−
** L-2-amino-3-ketobutyrate
 
−
** L-2-amino-3-oxobutyrate
 
−
** α-amino-β-ketobutyrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[THREOSPON-RXN]]
+
* With identifiers:
−
* [[AKBLIG-RXN]]
+
** 1 [[3R-11Z-3-hydroxy-icos-11-enoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[2E-11Z-icosa-2-11-dienoyl-ACPs]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-16000]]
+
** 1 a (3R,11Z)-3-hydroxy-icos-11-enoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 an (2E,11Z)-icosa-2,11-dienoyl-[acp][c]
−
* [[THREODEHYD-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6884]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7663]], gondoate biosynthesis (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7663 PWY-7663]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289686 86289686]
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
−
* HMDB : HMDB06454
+
{{#set: ec number=EC-4.2.1.59}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_6884}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03508 C03508]
+
{{#set: in pathway=PWY-7663}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.4573764.html 4573764]
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78948 78948]
+
−
* BIGG : 2aobut
+
−
{{#set: smiles=CC(=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N}}
+
−
{{#set: common name=L-2-amino-3-oxobutanoate}}
+
−
{{#set: molecular weight=117.104    }}
+
−
{{#set: common name=3-oxothreonine|3-keto-L-threonine|L-2-amino-acetoacetate|L-2-amino-3-ketobutyrate|L-2-amino-3-oxobutyrate|α-amino-β-ketobutyrate}}
+
−
{{#set: consumed by=THREOSPON-RXN|AKBLIG-RXN}}
+
−
{{#set: produced by=RXN-16000|THREODEHYD-RXN}}
+

Revision as of 15:56, 21 March 2018

Reaction RXN-16631

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7663, gondoate biosynthesis (anaerobic): PWY-7663
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3113&oldid=37431"