Difference between revisions of "RXN-3521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * smiles: ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12861 RXN-12861] == * direction: ** LEFT-TO-RIGHT * common name: ** dehydroascorbate hydrolase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12861 RXN-12861] ==
−
* smiles:
+
* direction:
−
** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M
+
 
* common name:
 
* common name:
−
** L-saccharopine
+
** dehydroascorbate hydrolase
−
* molecular weight:
+
−
** 275.281   
+
 
* Synonym(s):
 
* Synonym(s):
−
** saccharopine
 
−
** N6-(L-1,3-dicarboxypropyl)-L-lysine
 
−
** ε-N-(L-glutar-2-yl)-L-lysine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.5.1.7-RXN]]
+
* With identifiers:
−
* [[1.5.1.9-RXN]]
+
** 1 [[CPD-13907]][c] '''=>''' 1 [[CPD-334]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[1.5.1.8-RXN]]
+
** 1 dehydroascorbate (bicyclic form)[c] '''=>''' 1 2,3-dioxo-L-gulonate[c] '''+''' 1 H+[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6959]], L-ascorbate degradation V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
* [[PWY-6961]], L-ascorbate degradation II (bacterial, aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6961 PWY-6961]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00449 C00449]
+
{{#set: common name=dehydroascorbate hydrolase}}
−
* CHEBI:
+
{{#set: in pathway=PWY-6959|PWY-6961}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57951 57951]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC57951
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791954 49791954]
+
−
* HMDB : HMDB00279
+
−
{{#set: smiles=C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ZDGJAHTZVHVLOT-YUMQZZPRSA-M}}
+
−
{{#set: common name=L-saccharopine}}
+
−
{{#set: molecular weight=275.281    }}
+
−
{{#set: common name=saccharopine|N6-(L-1,3-dicarboxypropyl)-L-lysine|ε-N-(L-glutar-2-yl)-L-lysine}}
+
−
{{#set: consumed by=1.5.1.7-RXN|1.5.1.9-RXN}}
+
−
{{#set: produced by=1.5.1.8-RXN}}
+

Revision as of 15:56, 21 March 2018

Reaction RXN-12861

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dehydroascorbate hydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dehydroascorbate (bicyclic form)[c] => 1 2,3-dioxo-L-gulonate[c] + 1 H+[c]

Genes associated with this reaction

Pathways

  • PWY-6959, L-ascorbate degradation V: PWY-6959
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-6961, L-ascorbate degradation II (bacterial, aerobic): PWY-6961
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-3521&oldid=37438"