Difference between revisions of "Tiso gene 17517"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-ferredoxins Oxidized-ferredoxins] == * common name: ** an oxidized ferredoxin [iron-su...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta5,23-3-oxo-C42...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-182 RXN1G-182] == |
| + | * direction: | ||
| + | ** LEFT-TO-RIGHT | ||
* common name: | * common name: | ||
| − | ** | + | ** cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase |
| + | * ec number: | ||
| + | ** [http://enzyme.expasy.org/EC/1.1.1.M9 EC-1.1.1.M9] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 1 [[cis-cis-D5-23-3-oxo-C42-2-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[cis-cis-D5-23-3-hydroxyC42-2-ACPs]][c] |
| − | + | * With common name(s): | |
| − | + | ** 1 a cis,cis-delta5,23-3-oxo-C42:2-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a cis,cis-delta5,23-3-hydroxyC42:2-[acp][c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | + | Genes have been associated with this reaction based on different elements listed below. | |
| − | + | * Gene: [[Tiso_gene_13083]] | |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | + | == Pathways == | |
| − | + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | |
| − | + | ** '''86''' reactions found over '''182''' reactions in the full pathway | |
| − | * | + | == Reconstruction information == |
| − | * | + | * Category: [[orthology]] |
| − | + | ** Source: [[orthology-esiliculosus]] | |
| − | + | *** Tool: [[pantograph]] | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase}} |
| − | {{#set: | + | {{#set: ec number=EC-1.1.1.M9}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_13083}} |
| − | {{#set: | + | {{#set: in pathway=PWYG-321}} |
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction source=orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Revision as of 15:56, 21 March 2018
Contents
Reaction RXN1G-182
- direction:
- LEFT-TO-RIGHT
- common name:
- cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 cis-cis-D5-23-3-oxo-C42-2-ACPs[c] + 1 PROTON[c] + 1 NADPH[c] => 1 NADP[c] + 1 cis-cis-D5-23-3-hydroxyC42-2-ACPs[c]
- With common name(s):
- 1 a cis,cis-delta5,23-3-oxo-C42:2-[acp][c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 a cis,cis-delta5,23-3-hydroxyC42:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13083
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
"cis,cis-delta5,23-3-oxo-C42:2-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
