Difference between revisions of "Tiso gene 7286"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16627 RXN-16627] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16627 RXN-16627] ==
−
* smiles:
+
* direction:
−
** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 5-hydroxytryptophol glucuronide
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
−
* molecular weight:
+
* ec number:
−
** 353.328   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10784]]
+
** 1 [[3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs]][c] '''=>''' 1 [[2E-9Z-octadeca-2-9-dienoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R,9Z)-3-hydroxy-octadec-9-enoyl-[acp][c] '''=>''' 1 a (2E,9Z)-octadeca-2,9-dienoyl-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6884]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086]
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
−
{{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}}
+
{{#set: ec number=EC-4.2.1.59}}
−
{{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}}
+
{{#set: gene associated=Tiso_gene_6884}}
−
{{#set: common name=5-hydroxytryptophol glucuronide}}
+
{{#set: in pathway=PWY-7664}}
−
{{#set: molecular weight=353.328    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: produced by=RXN-10784}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:56, 21 March 2018

Reaction RXN-16627

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7286&oldid=37463"