Difference between revisions of "ALLANTOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] == * common name: ** a 1,2-diglyceride * Synonym(s): ** a 1,...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
* inchi key:
+
** InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J
+
 
* common name:
 
* common name:
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA
+
** a 1,2-diglyceride
* molecular weight:
+
** 1001.785   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 1,2-diacylglycerol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12750]]
+
* [[RXN-1602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 1,2-diglyceride}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657574 90657574]
+
{{#set: common name=a 1,2-diacylglycerol}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: consumed by=RXN-1602}}
{{#set: inchi key=InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J}}
+
{{#set: produced by=TRIACYLGLYCEROL-LIPASE-RXN}}
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA}}
+
{{#set: molecular weight=1001.785    }}
+
{{#set: consumed by=RXN-12750}}
+

Revision as of 16:56, 21 March 2018

Metabolite 1-2-Diglycerides

  • common name:
    • a 1,2-diglyceride
  • Synonym(s):
    • a 1,2-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links