Difference between revisions of "Sulfurylated-ThiI"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * smiles: ** C(C([N+])C(=O)[O-])S([O-])=O * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16557 RXN-16557] ==
−
* smiles:
+
* direction:
−
** C(C([N+])C(=O)[O-])S([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ADVPTQAUNPRNPO-REOHCLBHSA-M
+
 
* common name:
 
* common name:
−
** 3-sulfinoalanine
+
** acyl-coenzyme_a_oxidase
−
* molecular weight:
+
** acyl-_dehydrogenase
−
** 152.145   
+
** ORF
 +
** acyl-CoA_dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.8.9 EC-1.3.8.9]
 
* Synonym(s):
 
* Synonym(s):
−
** cysteine sulfinate
 
−
** cysteine sulphinate
 
−
** L-cysteine sulfinate
 
−
** 3-sulfino-L-alanine
 
−
** L-cysteinesulfinic acid
 
−
** 3-sulphino-L-alanine
 
−
** cysteine-sulfinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[CYSTEINE-DIOXYGENASE-RXN]]
+
** 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-16001]][c] '''=>''' 1 [[ETF-Reduced]][c] '''+''' 1 [[CPD-17813]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
** 1 an oxidized electron-transfer flavoprotein[c] '''+''' 1 H+[c] '''+''' 1 (11Z)-hexadecenoyl-CoA[c] '''=>''' 1 a reduced electron-transfer flavoprotein[c] '''+''' 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_883]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5991]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16631]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6475]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7656]], Spodoptera littoralis pheromone biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7656 PWY-7656]
 +
** '''6''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1115-65-7
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC61085
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
−
* PUBCHEM:
+
{{#set: common name=acyl-_dehydrogenase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549097 1549097]
+
{{#set: common name=ORF}}
−
* HMDB : HMDB60179
+
{{#set: common name=acyl-CoA_dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.3.8.9}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00606 C00606]
+
{{#set: gene associated=Tiso_gene_17967|Tiso_gene_18566|Tiso_gene_883|Tiso_gene_5991|Tiso_gene_16631|Tiso_gene_6475}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-7656}}
−
** [http://www.chemspider.com/Chemical-Structure.1266064.html 1266064]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61085 61085]
+
{{#set: reconstruction tool=pathwaytools}}
−
* BIGG : 3sala
+
−
{{#set: smiles=C(C([N+])C(=O)[O-])S([O-])=O}}
+
−
{{#set: inchi key=InChIKey=ADVPTQAUNPRNPO-REOHCLBHSA-M}}
+
−
{{#set: common name=3-sulfinoalanine}}
+
−
{{#set: molecular weight=152.145    }}
+
−
{{#set: common name=cysteine sulfinate|cysteine sulphinate|L-cysteine sulfinate|3-sulfino-L-alanine|L-cysteinesulfinic acid|3-sulphino-L-alanine|cysteine-sulfinate}}
+
−
{{#set: produced by=CYSTEINE-DIOXYGENASE-RXN}}
+
−
{{#set: reversible reaction associated=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}}
+

Revision as of 16:56, 21 March 2018

Reaction RXN-16557

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
    • acyl-_dehydrogenase
    • ORF
    • acyl-CoA_dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 an oxidized electron-transfer flavoprotein[c] + 1 H+[c] + 1 (11Z)-hexadecenoyl-CoA[c] => 1 a reduced electron-transfer flavoprotein[c] + 1 (2E,11Z)-hexadec-2,11-dienoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7656, Spodoptera littoralis pheromone biosynthesis: PWY-7656
    • 6 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Sulfurylated-ThiI&oldid=37486"