Difference between revisions of "Red-Thioredoxin"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(OP([O-])([O-])=O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-882 RXN0-882] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.17.7.1 EC-1.17.7.1] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[Oxidized-ferredoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[HYDROXY-METHYL-BUTENYL-DIP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H+[c] '''=>''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''+''' 1 H2O[c] '''+''' 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_15758]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560] | ||
| + | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08689 R08689] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.17.7.1}} | |
| − | * LIGAND- | + | {{#set: gene associated=Tiso_gene_15758}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-7560}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis|orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:56, 21 March 2018
Contents
Reaction RXN0-882
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE[c] + 2 Reduced-ferredoxins[c] + 1 PROTON[c] => 2 Oxidized-ferredoxins[c] + 1 WATER[c] + 1 HYDROXY-METHYL-BUTENYL-DIP[c]
- With common name(s):
- 1 2-C-methyl-D-erythritol-2,4-cyclodiphosphate[c] + 2 a reduced ferredoxin [iron-sulfur] cluster[c] + 1 H+[c] => 2 an oxidized ferredoxin [iron-sulfur] cluster[c] + 1 H2O[c] + 1 (E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15758
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
Pathways
- PWY-7560, methylerythritol phosphate pathway II: PWY-7560
- 9 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-synechocystis
External links
- LIGAND-RXN:
