Difference between revisions of "MI-HEXAKISPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannuronates D-mannuronates] == * common name: ** D-mannuronate * Synonym(s): ** D-mannuronic...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-mannuronates D-mannuronates] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-mannuronate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-mannuronic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[MANNURONATE-REDUCTASE-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=D-mannuronate}} | |
− | + | {{#set: common name=D-mannuronic acid}} | |
− | + | {{#set: reversible reaction associated=MANNURONATE-REDUCTASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 15:56, 21 March 2018
Contents
Metabolite D-mannuronates
- common name:
- D-mannuronate
- Synonym(s):
- D-mannuronic acid