Difference between revisions of "Tiso gene 3651"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
(Created page with "Category:Gene == Gene Tiso_gene_6736 == * right end position: ** 11812 * transcription direction: ** POSITIVE * left end position: ** 9056 * centisome position: ** 76.1520...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_6736 == |
| − | * | + | * right end position: |
| − | ** | + | ** 11812 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| + | * left end position: | ||
| + | ** 9056 | ||
| + | * centisome position: | ||
| + | ** 76.15203 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[LIPIDADISACCHARIDESYNTH-RXN]] | |
| − | == | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
| + | * [[NAGLIPASYN-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=11812}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=9056}} |
| − | {{#set: | + | {{#set: centisome position=76.15203 }} |
| − | {{#set: | + | {{#set: reaction associated=LIPIDADISACCHARIDESYNTH-RXN}} |
| + | {{#set: pathway associated=NAGLIPASYN-PWY}} | ||
Revision as of 15:56, 21 March 2018
Gene Tiso_gene_6736
- right end position:
- 11812
- transcription direction:
- POSITIVE
- left end position:
- 9056
- centisome position:
- 76.15203
- Synonym(s):
Reactions associated
- Reaction: LIPIDADISACCHARIDESYNTH-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
