Difference between revisions of "Tiso gene 15059"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)OP(=O)([O-])[O-]))O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] == * common name: ** an S-sulfanyl-[ThiI sulfur-carrier pr...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)OP(=O)([O-])[O-]))OP([O-])([O-])=O
+
* inchi key:
+
** InChIKey=WHTCPDAXWFLDIH-KQYNXXCUSA-J
+
 
* common name:
 
* common name:
** adenosine 3',5'-bisphosphate
+
** an S-sulfanyl-[ThiI sulfur-carrier protein]
* molecular weight:
+
** 423.172   
+
 
* Synonym(s):
 
* Synonym(s):
** adenosine-3',5'-bisphosphate
+
** a sulfurylated sulfur-carrier protein ThiI
** 3',5'-ADP
+
** a ThiI persulfide
** phosphoadenosine phosphate
+
** PAP
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18303]]
+
* [[RXN-14382]]
* [[RXN-18301]]
+
* [[RXN-10614]]
+
* [[RXN-10615]]
+
* [[HOLO-ACP-SYNTH-RXN]]
+
* [[RXN-15889]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-11059]]
+
* [[RXN-10777]]
+
* [[ENTDB-RXN]]
+
* [[RXN6666-9]]
+
* [[RXN-10782]]
+
* [[RXN-11058]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-16759]]
+
* [[RXN-9787]]
* [[PAPSPAPtm]]
+
* [[PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN]]
+
* [[RXN-15588]]
+
* [[ARYL-SULFOTRANSFERASE-RXN]]
+
* [[1.8.4.8-RXN]]
+
* [[RXN-15589]]
+
* [[RXN-10994]]
+
* [[RXN-17203]]
+
* [[RXN-15587]]
+
* [[PAPSPAPthr]]
+
 
== External links  ==
 
== External links  ==
* CAS : 1053-73-2
+
{{#set: common name=an S-sulfanyl-[ThiI sulfur-carrier protein]}}
* METABOLIGHTS : MTBLC58343
+
{{#set: common name=a sulfurylated sulfur-carrier protein ThiI|a ThiI persulfide}}
* PUBCHEM:
+
{{#set: produced by=RXN-14382}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615194 23615194]
+
{{#set: reversible reaction associated=RXN-9787}}
* HMDB : HMDB00061
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00054 C00054]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.19951095.html 19951095]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58343 58343]
+
* BIGG : pap
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)OP(=O)([O-])[O-]))OP([O-])([O-])=O}}
+
{{#set: inchi key=InChIKey=WHTCPDAXWFLDIH-KQYNXXCUSA-J}}
+
{{#set: common name=adenosine 3',5'-bisphosphate}}
+
{{#set: molecular weight=423.172    }}
+
{{#set: common name=adenosine-3',5'-bisphosphate|3',5'-ADP|phosphoadenosine phosphate|PAP}}
+
{{#set: consumed by=325-BISPHOSPHATE-NUCLEOTIDASE-RXN}}
+
{{#set: produced by=RXN-18303|RXN-18301|RXN-10614|RXN-10615|HOLO-ACP-SYNTH-RXN|RXN-15889|GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-11059|RXN-10777|ENTDB-RXN|RXN6666-9|RXN-10782|RXN-11058}}
+
{{#set: reversible reaction associated=RXN-16759|PAPSPAPtm|PROTEIN-TYROSINE-SULFOTRANSFERASE-RXN|RXN-15588|ARYL-SULFOTRANSFERASE-RXN|1.8.4.8-RXN|RXN-15589|RXN-10994|RXN-17203|RXN-15587|PAPSPAPthr}}
+

Revision as of 15:57, 21 March 2018

Metabolite Sulfurylated-ThiI

  • common name:
    • an S-sulfanyl-[ThiI sulfur-carrier protein]
  • Synonym(s):
    • a sulfurylated sulfur-carrier protein ThiI
    • a ThiI persulfide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an S-sulfanyl-[ThiI sulfur-carrier protein" cannot be used as a page name in this wiki.