Difference between revisions of "ETHANOLAMINE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D9-21-C40-3-ACPs trans-D2-cis-cis-D9-21-C40-3-ACPs] == * common name: ** a tra...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * common name: ** S-methyl-L-methio...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == |
+ | * smiles: | ||
+ | ** C[S+](CCC([N+])C(=O)[O-])C | ||
* common name: | * common name: | ||
− | ** | + | ** S-methyl-L-methionine |
+ | * inchi key: | ||
+ | ** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O | ||
+ | * molecular weight: | ||
+ | ** 164.242 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** S-methylmethionine |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[MMUM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638] |
− | {{#set: consumed by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252] | ||
+ | * BIGG : mmet | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172] | ||
+ | {{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}} | ||
+ | {{#set: common name=S-methyl-L-methionine}} | ||
+ | {{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}} | ||
+ | {{#set: molecular weight=164.242 }} | ||
+ | {{#set: common name=S-methylmethionine}} | ||
+ | {{#set: consumed by=MMUM-RXN}} |
Revision as of 15:57, 21 March 2018
Contents
Metabolite CPD-397
- smiles:
- C[S+](CCC([N+])C(=O)[O-])C
- common name:
- S-methyl-L-methionine
- inchi key:
- InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
- molecular weight:
- 164.242
- Synonym(s):
- S-methylmethionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.