Difference between revisions of "3.4.21.50-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE-tRNAs ILE-tRNAs] == * common name: ** a tRNAile * Synonym(s): ** TRNA(ILE) == Reaction(s)...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE-tRNAs ILE-tRNAs] ==
* smiles:
+
** C([N+])COP([O-])(=O)OCC(O)CO[R]
+
 
* common name:
 
* common name:
** 1-alkyl-sn-glycero-3-phosphoethanolamine
+
** a tRNAile
 
* Synonym(s):
 
* Synonym(s):
** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
+
** TRNA(ILE)
** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
+
** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[LPLPS1AGPE180]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: common name=a tRNAile}}
** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476]
+
{{#set: common name=TRNA(ILE)}}
* CHEBI:
+
{{#set: consumed by=ISOLEUCINE--TRNA-LIGASE-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244]
+
{{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}}
+
{{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
+
{{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}}
+
{{#set: produced by=LPLPS1AGPE180}}
+

Revision as of 15:57, 21 March 2018

Metabolite ILE-tRNAs

  • common name:
    • a tRNAile
  • Synonym(s):
    • TRNA(ILE)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links