Difference between revisions of "R00471"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-] *...")
(Created page with "Category:Gene == Gene Tiso_gene_14162 == * Synonym(s): == Reactions associated == * Reaction: RIBITOL-2-DEHYDROGENASE-RXN ** Source: orthology-esiliculosus == Pat...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] ==
+
== Gene Tiso_gene_14162 ==
* smiles:
+
** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]
+
* inchi key:
+
** InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O
+
* common name:
+
** L-4-hydroxyphenylglycine-L-arginine
+
* molecular weight:
+
** 324.359   
+
 
* Synonym(s):
 
* Synonym(s):
** L-pHPG-L-Arg
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RIBITOL-2-DEHYDROGENASE-RXN]]
* [[RXN-17832]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[RIBITOLUTIL-PWY]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]}}
+
{{#set: reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}}
{{#set: inchi key=InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O}}
+
{{#set: pathway associated=RIBITOLUTIL-PWY}}
{{#set: common name=L-4-hydroxyphenylglycine-L-arginine}}
+
{{#set: molecular weight=324.359    }}
+
{{#set: common name=L-pHPG-L-Arg}}
+
{{#set: produced by=RXN-17832}}
+

Revision as of 16:57, 21 March 2018

Gene Tiso_gene_14162

  • Synonym(s):

Reactions associated

Pathways associated

External links