Difference between revisions of "Tiso gene 6640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9654 RXN-9654] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** 3-oxoa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9654 RXN-9654] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polyketide_synthase |
− | * | + | ** 3-oxoacyl-synthase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PROTON]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[3-oxo-palmitoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H+[c] '''+''' 1 a myristoyl-[acp][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 a 3-oxo-palmitoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15991]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_136]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_19302]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_500]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13394]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14485]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_135]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_10876]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_5939]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=polyketide_synthase}} | |
− | + | {{#set: common name=3-oxoacyl-synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.86}} | |
− | + | {{#set: ec number=EC-2.3.1.85}} | |
− | + | {{#set: ec number=EC-2.3.1.41}} | |
− | + | {{#set: gene associated=Tiso_gene_15991|Tiso_gene_136|Tiso_gene_19302|Tiso_gene_500|Tiso_gene_13394|Tiso_gene_14485|Tiso_gene_135|Tiso_gene_10876|Tiso_gene_5939}} | |
− | + | {{#set: in pathway=PWY-5994}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:57, 21 March 2018
Contents
Reaction RXN-9654
- direction:
- LEFT-TO-RIGHT
- common name:
- polyketide_synthase
- 3-oxoacyl-synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 Myristoyl-ACPs[c] + 1 MALONYL-COA[c] => 1 3-oxo-palmitoyl-ACPs[c] + 1 CARBON-DIOXIDE[c] + 1 CO-A[c]
- With common name(s):
- 1 H+[c] + 1 a myristoyl-[acp][c] + 1 malonyl-CoA[c] => 1 a 3-oxo-palmitoyl-[acp][c] + 1 CO2[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15991
- Source: orthology-esiliculosus
- Gene: Tiso_gene_136
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19302
- Source: orthology-esiliculosus
- Gene: Tiso_gene_500
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14485
- Source: orthology-esiliculosus
- Gene: Tiso_gene_135
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_10876
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5939
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation