Difference between revisions of "3-Ketoglutaryl-ACP-methyl-ester"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * smiles: ** C1(C(=CC(=C(C=1)O)CC([O-])=O)O) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9951 RXN-9951] == * direction: ** REVERSIBLE * common name: ** isocitrate dehydrogenase (NADP+)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9951 RXN-9951] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** isocitrate dehydrogenase (NADP+) |
− | + | ** ORF | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** oxalosuccinate decarboxylase |
+ | ** oxalsuccinic decarboxylase | ||
+ | ** isocitrate (NADP) dehydrogenase | ||
+ | ** isocitrate (nicotinamide adenine dinucleotide phosphate) dehydrogenase | ||
+ | ** NADP-specific isocitrate dehydrogenase | ||
+ | ** NADP-linked isocitrate dehydrogenase | ||
+ | ** NADP isocitric dehydrogenase | ||
+ | ** isocitrate dehydrogenase (NADP-dependent) | ||
+ | ** NADP-dependent isocitric dehydrogenase | ||
+ | ** triphosphopyridine nucleotide-linked isocitrate dehydrogenase-oxalosuccinate carboxylase | ||
+ | ** NADP+-linked isocitrate dehydrogenase | ||
+ | ** IDH (ambiguous) | ||
+ | ** dual-cofactor-specific isocitrate dehydrogenase | ||
+ | ** NADP+-ICDH | ||
+ | ** NADP+-IDH | ||
+ | ** IDP | ||
+ | ** IDP1 | ||
+ | ** IDP2 | ||
+ | ** IDP3 | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[THREO-DS-ISO-CITRATE]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[OXALO-SUCCINATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 D-threo-isocitrate[c] '''+''' 1 NADP+[c] '''<=>''' 1 oxalosuccinate[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
+ | * Gene: [[Tiso_gene_10809]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_18262]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25588 25588] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01899 R01899] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: common name=isocitrate dehydrogenase (NADP+)}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: common name=oxalosuccinate decarboxylase|oxalsuccinic decarboxylase|isocitrate (NADP) dehydrogenase|isocitrate (nicotinamide adenine dinucleotide phosphate) dehydrogenase|NADP-specific isocitrate dehydrogenase|NADP-linked isocitrate dehydrogenase|NADP isocitric dehydrogenase|isocitrate dehydrogenase (NADP-dependent)|NADP-dependent isocitric dehydrogenase|triphosphopyridine nucleotide-linked isocitrate dehydrogenase-oxalosuccinate carboxylase|NADP+-linked isocitrate dehydrogenase|IDH (ambiguous)|dual-cofactor-specific isocitrate dehydrogenase|NADP+-ICDH|NADP+-IDH|IDP|IDP1|IDP2|IDP3}} | |
− | + | {{#set: gene associated=Tiso_gene_10809|Tiso_gene_18262}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:57, 21 March 2018
Contents
Reaction RXN-9951
- direction:
- REVERSIBLE
- common name:
- isocitrate dehydrogenase (NADP+)
- ORF
- Synonym(s):
- oxalosuccinate decarboxylase
- oxalsuccinic decarboxylase
- isocitrate (NADP) dehydrogenase
- isocitrate (nicotinamide adenine dinucleotide phosphate) dehydrogenase
- NADP-specific isocitrate dehydrogenase
- NADP-linked isocitrate dehydrogenase
- NADP isocitric dehydrogenase
- isocitrate dehydrogenase (NADP-dependent)
- NADP-dependent isocitric dehydrogenase
- triphosphopyridine nucleotide-linked isocitrate dehydrogenase-oxalosuccinate carboxylase
- NADP+-linked isocitrate dehydrogenase
- IDH (ambiguous)
- dual-cofactor-specific isocitrate dehydrogenase
- NADP+-ICDH
- NADP+-IDH
- IDP
- IDP1
- IDP2
- IDP3
Reaction Formula
- With identifiers:
- 1 THREO-DS-ISO-CITRATE[c] + 1 NADP[c] <=> 1 OXALO-SUCCINATE[c] + 1 PROTON[c] + 1 NADPH[c]
- With common name(s):
- 1 D-threo-isocitrate[c] + 1 NADP+[c] <=> 1 oxalosuccinate[c] + 1 H+[c] + 1 NADPH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10809
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_18262
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links