Difference between revisions of "CPD-696"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-676 CPD-676] == * smiles: ** C([O-])(=O)C=CC1(C=C(O)C(O)=CC=1) * inchi key: ** InChIKey=QAI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPGUANYLTRANGDP-RXN MANNPGUANYLTRANGDP-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPGUANYLTRANGDP-RXN MANNPGUANYLTRANGDP-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.22 EC-2.7.7.22] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[MANNOSE-1P]][c] '''+''' 1 [[GDP]][c] '''+''' 1 [[PROTON]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[GDP-MANNOSE]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 α-D-mannose 1-phosphate[c] '''+''' 1 GDP[c] '''+''' 1 H+[c] '''<=>''' 1 phosphate[c] '''+''' 1 GDP-α-D-mannose[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14704]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12905 12905] |
− | + | * LIGAND-RXN: | |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00883 R00883] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P07874 P07874] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P24174 P24174] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | ** [http://www. | + | {{#set: ec number=EC-2.7.7.22}} |
− | + | {{#set: gene associated=Tiso_gene_14704}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-athaliana}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:57, 21 March 2018
Contents
Reaction MANNPGUANYLTRANGDP-RXN
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MANNOSE-1P[c] + 1 GDP[c] + 1 PROTON[c] <=> 1 Pi[c] + 1 GDP-MANNOSE[c]
- With common name(s):
- 1 α-D-mannose 1-phosphate[c] + 1 GDP[c] + 1 H+[c] <=> 1 phosphate[c] + 1 GDP-α-D-mannose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14704
- Source: orthology-athaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links