Difference between revisions of "O-phospho-L-seryl-tRNASecs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFL FTHFL] == * direction: ** LEFT-TO-RIGHT * common name: ** Formate--tetrahydrofolate ligase *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FTHFL FTHFL] ==
* smiles:
+
* direction:
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
+
 
* common name:
 
* common name:
** zeinoxanthin
+
** Formate--tetrahydrofolate ligase
* molecular weight:
+
** 552.882   
+
 
* Synonym(s):
 
* Synonym(s):
** β,ε-carotene-3-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-5962]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[FORMATE]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[THF]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[10-FORMYL-THF]][c] '''+''' 1.0 [[Pi]][c]
* [[RXN-5961]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 formate[c] '''+''' 1.0 ATP[c] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7582]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902]
+
{{#set: common name=Formate--tetrahydrofolate ligase}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_7582}}
** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590]
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}}
+
{{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}}
+
{{#set: common name=zeinoxanthin}}
+
{{#set: molecular weight=552.882    }}
+
{{#set: common name=β,ε-carotene-3-ol}}
+
{{#set: consumed by=RXN-5962}}
+
{{#set: produced by=RXN-5961}}
+

Revision as of 16:57, 21 March 2018

Reaction FTHFL

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Formate--tetrahydrofolate ligase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 formate[c] + 1.0 ATP[c] + 1.0 tetrahydropteroyl mono-L-glutamate[c] => 1.0 ADP[c] + 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] + 1.0 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links