Difference between revisions of "Tiso gene 6012"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16621 RXN-16621] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16621 RXN-16621] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HOBAELRKJCKHQD-QNEBEIHSSA-M
+
 
* common name:
 
* common name:
−
** di-homo-γ-linolenate
+
** 3-oxoacyl-synthase
−
* molecular weight:
+
* ec number:
−
** 305.479   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z)-eicosatrienoic acid
 
−
** DGLA
 
−
** (8Z,11Z,14Z)-eicosatri-8,11,14-enoate
 
−
** (8Z,11Z,14Z)-icosatrienoate
 
−
** di-homo-γ-linolenic acid
 
−
** (Z,Z,Z)-8,11,14-eicosatrienoic acid
 
−
** (Z,Z,Z)-8,11,14-eicosatrienoate
 
−
** (8Z,11Z,14Z)-eicosatrienoate
 
−
** (8Z,11Z,14Z)-icosatrienoic acid
 
−
** (8Z,11Z,14Z)-icosa-8,11,14-trienoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-13435]]
+
** 1 [[5Z-tetradec-5-enoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[7Z-3-oxo-hexadec-7-enoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (5Z)-tetradec-5-enoyl-[acp][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a (7Z)-3-oxo-hexadec-7-enoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664]
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* Wikipedia : Dihomo-gamma-linolenic_acid
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-oxoacyl-synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21158448 21158448]
+
{{#set: ec number=EC-2.3.1.41}}
−
* HMDB : HMDB02925
+
{{#set: gene associated=Tiso_gene_5939}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7664}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03242 C03242]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.20117973.html 20117973]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71589 71589]
+
−
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=HOBAELRKJCKHQD-QNEBEIHSSA-M}}
+
−
{{#set: common name=di-homo-γ-linolenate}}
+
−
{{#set: molecular weight=305.479    }}
+
−
{{#set: common name=(8Z,11Z,14Z)-eicosatrienoic acid|DGLA|(8Z,11Z,14Z)-eicosatri-8,11,14-enoate|(8Z,11Z,14Z)-icosatrienoate|di-homo-γ-linolenic acid|(Z,Z,Z)-8,11,14-eicosatrienoic acid|(Z,Z,Z)-8,11,14-eicosatrienoate|(8Z,11Z,14Z)-eicosatrienoate|(8Z,11Z,14Z)-icosatrienoic acid|(8Z,11Z,14Z)-icosa-8,11,14-trienoate}}
+
−
{{#set: produced by=RXN-13435}}
+

Revision as of 15:57, 21 March 2018

Reaction RXN-16621

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6012&oldid=37647"