Difference between revisions of "Trans-D2-cis-cis-D19-31-C50-3-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-arachidoyl-ACPs 3-oxo-arachidoyl-ACPs] == * common name: ** a 3-oxo-arachidoyl-[acp] * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * smiles: ** C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1) * common name: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == |
+ | * smiles: | ||
+ | ** C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1) | ||
* common name: | * common name: | ||
− | ** | + | ** 4-nitrophenyl phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=XZKIHKMTEMTJQX-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 217.074 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** para-nitrophenyl phosphate |
+ | ** nitrophenol-P | ||
+ | ** NO2-phen-P | ||
+ | ** nitrophenol-phosphate | ||
+ | ** p-nitrophenyl phosphate | ||
+ | ** pNPP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 330-13-2 |
− | {{#set: common name= | + | * Wikipedia : Para-Nitrophenylphosphate |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4686862 4686862] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03360 C03360] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3874764.html 3874764] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61146 61146] | ||
+ | * METABOLIGHTS : MTBLC61146 | ||
+ | {{#set: smiles=C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1)}} | ||
+ | {{#set: common name=4-nitrophenyl phosphate}} | ||
+ | {{#set: inchi key=InChIKey=XZKIHKMTEMTJQX-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=217.074 }} | ||
+ | {{#set: common name=para-nitrophenyl phosphate|nitrophenol-P|NO2-phen-P|nitrophenol-phosphate|p-nitrophenyl phosphate|pNPP}} | ||
+ | {{#set: consumed by=4-NITROPHENYLPHOSPHATASE-RXN}} |
Revision as of 15:57, 21 March 2018
Contents
Metabolite CPD-194
- smiles:
- C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1)
- common name:
- 4-nitrophenyl phosphate
- inchi key:
- InChIKey=XZKIHKMTEMTJQX-UHFFFAOYSA-L
- molecular weight:
- 217.074
- Synonym(s):
- para-nitrophenyl phosphate
- nitrophenol-P
- NO2-phen-P
- nitrophenol-phosphate
- p-nitrophenyl phosphate
- pNPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 330-13-2
- Wikipedia : Para-Nitrophenylphosphate
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC61146
"C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1)" cannot be used as a page name in this wiki.