Difference between revisions of "Tiso gene 12533"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINAMIDE_RIBOSE NICOTINAMIDE_RIBOSE] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isopr...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == |
* smiles: | * smiles: | ||
− | ** | + | ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate |
+ | * inchi key: | ||
+ | ** InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 232.251 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-18207]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-18206]] | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}} | |
− | + | {{#set: common name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}} | |
− | + | {{#set: inchi key=InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L}} | |
− | + | {{#set: molecular weight=232.251 }} | |
− | + | {{#set: consumed by=RXN-18207}} | |
− | + | {{#set: reversible reaction associated=RXN-18206}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:57, 21 March 2018
Contents
Metabolite CPD-19490
- smiles:
- CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
- common name:
- 3-isopropyl-7-(methylthio)-2-oxoheptanoate
- inchi key:
- InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
- molecular weight:
- 232.251
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.