Difference between revisions of "Delta4-hexadecenoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * common na...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C(CC(C(=O)[O-])[N+])ONC(N)=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** O-ureidohomoserine |
+ | * inchi key: | ||
+ | ** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 177.16 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483] |
− | * | + | * HMDB : HMDB12271 |
− | + | {{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}} | |
− | + | {{#set: common name=O-ureidohomoserine}} | |
− | + | {{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}} | |
− | {{#set: smiles=C | + | {{#set: molecular weight=177.16 }} |
− | {{#set: | + | {{#set: consumed by=RXN-10}} |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 15:57, 21 March 2018
Contents
Metabolite O-UREIDOHOMOSERINE
- smiles:
- C(CC(C(=O)[O-])[N+])ONC(N)=O
- common name:
- O-ureidohomoserine
- inchi key:
- InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
- molecular weight:
- 177.16
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12271
"C(CC(C(=O)[O-])[N+])ONC(N)=O" cannot be used as a page name in this wiki.