Difference between revisions of "RXN-9514"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sterols Sterols] == * common name: ** a sterol * Synonym(s): == Reaction(s) known to consume t...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] == * smiles: ** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2) * common name: ** 7...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sterols Sterols] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13043 CPD-13043] ==
 +
* smiles:
 +
** C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
 
* common name:
 
* common name:
** a sterol
+
** 7-carboxy-7-deazaguanine
 +
* inchi key:
 +
** InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 193.141   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12093]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[2.3.1.43-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a sterol}}
+
* PUBCHEM:
{{#set: reversible reaction associated=2.3.1.43-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852357 49852357]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61036 61036]
 +
{{#set: smiles=C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)}}
 +
{{#set: common name=7-carboxy-7-deazaguanine}}
 +
{{#set: inchi key=InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=193.141    }}
 +
{{#set: consumed by=RXN-12093}}

Revision as of 15:58, 21 March 2018

Metabolite CPD-13043

  • smiles:
    • C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)
  • common name:
    • 7-carboxy-7-deazaguanine
  • inchi key:
    • InChIKey=XIUIRSLBMMTDSK-UHFFFAOYSA-M
  • molecular weight:
    • 193.141
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C12(=C(C(C([O-])=O)=CN1)C(=O)NC(N)=N2)" cannot be used as a page name in this wiki.