Difference between revisions of "CPD-7496"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] == * direction: ** LEFT-TO-RIGHT * common name: ** Octanoyl-CoA:oxygen 2-oxidore...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA80or ACOA80or] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Octanoyl-CoA:oxygen 2-oxidoreductase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[CPD-196]][x] '''+''' 1.0 [[FAD]][x] '''=>''' 1.0 [[FADH2]][x] '''+''' 1.0 [[CPD0-2108]][x] |
− | == | + | * With common name(s): |
+ | ** 1.0 octanoyl-CoA[x] '''+''' 1.0 FAD[x] '''=>''' 1.0 FADH2[x] '''+''' 1.0 trans-oct-2-enoyl-CoA[x] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16674]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_8272]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17967]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Octanoyl-CoA:oxygen 2-oxidoreductase}} | |
− | + | {{#set: gene associated=Tiso_gene_16674|Tiso_gene_18566|Tiso_gene_8272|Tiso_gene_17967}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:58, 21 March 2018
Contents
Reaction ACOA80or
- direction:
- LEFT-TO-RIGHT
- common name:
- Octanoyl-CoA:oxygen 2-oxidoreductase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 octanoyl-CoA[x] + 1.0 FAD[x] => 1.0 FADH2[x] + 1.0 trans-oct-2-enoyl-CoA[x]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16674
- Source: orthology-creinhardtii
- Gene: Tiso_gene_18566
- Source: orthology-creinhardtii
- Gene: Tiso_gene_8272
- Source: orthology-creinhardtii
- Gene: Tiso_gene_17967
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii