Difference between revisions of "GTPPYPHOSKIN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8549 CPD-8549] == * common name: ** a D-threo-aldono-1,5-lactone * Synonym(s): == Reaction...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8549 CPD-8549] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] ==
 +
* smiles:
 +
** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
 
* common name:
 
* common name:
** a D-threo-aldono-1,5-lactone
+
** GDP-β-L-gulose
 +
* inchi key:
 +
** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
 +
* molecular weight:
 +
** 603.329   
 
* Synonym(s):
 
* Synonym(s):
  
Line 8: Line 14:
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[D-THREO-ALDOSE-1-DEHYDROGENASE-RXN]]
+
* [[RXN-7772]]
 +
* [[RXN-7771]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a D-threo-aldono-1,5-lactone}}
+
* PUBCHEM:
{{#set: reversible reaction associated=D-THREO-ALDOSE-1-DEHYDROGENASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925]
 +
{{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}}
 +
{{#set: common name=GDP-β-L-gulose}}
 +
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}}
 +
{{#set: molecular weight=603.329    }}
 +
{{#set: reversible reaction associated=RXN-7772|RXN-7771}}

Revision as of 16:58, 21 March 2018

Metabolite CPD-7078

  • smiles:
    • C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
  • common name:
    • GDP-β-L-gulose
  • inchi key:
    • InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
  • molecular weight:
    • 603.329
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O" cannot be used as a page name in this wiki.