Difference between revisions of "N-acetyl-beta-D-hexosamines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARIN COUMARIN] == * smiles: ** C1(OC2(=CC=CC=C(C=C1)2))=O * inchi key: ** InChIKey=ZYGHJZDH...") |
(Created page with "Category:Gene == Gene Tiso_gene_1035 == * Synonym(s): == Reactions associated == * Reaction: GPPSYN-RXN ** Source: orthology-esiliculosus * Reaction: [[RXN-11056]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1035 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GPPSYN-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-11056]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-11057]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-13064]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-8630]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-8872]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-146]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-161]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-163]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-169]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-181]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[UNSPECIFIC-MONOOXYGENASE-RXN]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7736]] | ||
+ | * [[PWY-7826]] | ||
+ | * [[PWY-5665]] | ||
+ | * [[PWY-6859]] | ||
+ | * [[PWY-7709]] | ||
+ | * [[PWY-7102]] | ||
+ | * [[PWY-7466]] | ||
+ | * [[PWY-7182]] | ||
+ | * [[PWY-7141]] | ||
+ | * [[PWY-5123]] | ||
+ | * [[PWY-5122]] | ||
+ | * [[PWY-5451]] | ||
+ | * [[PWY66-201]] | ||
+ | * [[PWY66-221]] | ||
+ | * [[PWY-6383]] | ||
+ | * [[PWY-7659]] | ||
+ | * [[PWY66-241]] | ||
+ | * [[PWY-7410]] | ||
+ | * [[PWY-6992]] | ||
+ | * [[PWY-6398]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GPPSYN-RXN|RXN-11056|RXN-11057|RXN-13064|RXN-8630|RXN-8872|RXN66-146|RXN66-161|RXN66-163|RXN66-169|RXN66-181|UNSPECIFIC-MONOOXYGENASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7736|PWY-7826|PWY-5665|PWY-6859|PWY-7709|PWY-7102|PWY-7466|PWY-7182|PWY-7141|PWY-5123|PWY-5122|PWY-5451|PWY66-201|PWY66-221|PWY-6383|PWY-7659|PWY66-241|PWY-7410|PWY-6992|PWY-6398}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Revision as of 15:58, 21 March 2018
Gene Tiso_gene_1035
- Synonym(s):
Reactions associated
- Reaction: GPPSYN-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-11056
- Source: orthology-esiliculosus
- Reaction: RXN-11057
- Source: orthology-esiliculosus
- Reaction: RXN-13064
- Source: orthology-esiliculosus
- Reaction: RXN-8630
- Source: orthology-esiliculosus
- Reaction: RXN-8872
- Source: orthology-esiliculosus
- Reaction: RXN66-146
- Source: orthology-esiliculosus
- Reaction: RXN66-161
- Source: orthology-esiliculosus
- Reaction: RXN66-163
- Source: orthology-esiliculosus
- Reaction: RXN66-169
- Source: orthology-esiliculosus
- Reaction: RXN66-181
- Source: orthology-esiliculosus
- Reaction: UNSPECIFIC-MONOOXYGENASE-RXN
- Source: orthology-esiliculosus
Pathways associated
- PWY-7736
- PWY-7826
- PWY-5665
- PWY-6859
- PWY-7709
- PWY-7102
- PWY-7466
- PWY-7182
- PWY-7141
- PWY-5123
- PWY-5122
- PWY-5451
- PWY66-201
- PWY66-221
- PWY-6383
- PWY-7659
- PWY66-241
- PWY-7410
- PWY-6992
- PWY-6398