Difference between revisions of "ACETOLACTSYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8743 RXN-8743] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8743 RXN-8743] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
+
** [http://enzyme.expasy.org/EC/3.1.8.1 EC-3.1.8.1]
−
* common name:
+
−
** prephytoene diphosphate
+
−
* molecular weight:
+
−
** 719.897   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (1R,2R,3R)-prephytoene diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXNARA-8002]]
+
* With identifiers:
−
* [[RXN-12245]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-8973]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[P-NITROPHENOL]][c] '''+''' 1 [[CPD-8974]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[2.5.1.32-RXN]]
+
** 1 H2O[c] '''+''' 1 methyl parathion[c] '''=>''' 2 H+[c] '''+''' 1 4-nitrophenol[c] '''+''' 1 dimethylthiophosphate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9894]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5489]], methyl parathion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5489 PWY-5489]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
+
{{#set: ec number=EC-3.1.8.1}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_9894}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
+
{{#set: in pathway=PWY-5489}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* HMDB : HMDB03023
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K}}
+
−
{{#set: common name=prephytoene diphosphate}}
+
−
{{#set: molecular weight=719.897    }}
+
−
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
+
−
{{#set: consumed by=RXNARA-8002|RXN-12245}}
+
−
{{#set: produced by=2.5.1.32-RXN}}
+

Revision as of 15:58, 21 March 2018

Reaction RXN-8743

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 methyl parathion[c] => 2 H+[c] + 1 4-nitrophenol[c] + 1 dimethylthiophosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5489, methyl parathion degradation: PWY-5489
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACETOLACTSYN-RXN&oldid=37739"