Difference between revisions of "RXN-17917"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * smiles: ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta4-hexadecenoyl-ACPs Delta4-hexadecenoyl-ACPs] == * common name: ** a (4Z)-hexadec-4-enoyl-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Delta4-hexadecenoyl-ACPs Delta4-hexadecenoyl-ACPs] ==
* smiles:
+
** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
+
 
* common name:
 
* common name:
** acryloyl-CoA
+
** a (4Z)-hexadec-4-enoyl-[acp]
* molecular weight:
+
** 817.551   
+
 
* Synonym(s):
 
* Synonym(s):
** acrylyl-coenzyme A
+
** a Δ4-hexadecenoyl-[acyl-carrier-protein]
** propenoyl-CoA
+
** a Δ4-hexadecenoyl-[acp]
** acrylyl-CoA
+
** a (4Z)-hexadecenoyl-[acp]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8391]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[PPCOAOm]]
 
* [[RXN-6383]]
 
 
== External links  ==
 
== External links  ==
* CAS : 5776-58-9
+
{{#set: common name=a (4Z)-hexadec-4-enoyl-[acp]}}
* PUBCHEM:
+
{{#set: common name=a Δ4-hexadecenoyl-[acyl-carrier-protein]|a Δ4-hexadecenoyl-[acp]|a (4Z)-hexadecenoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595]
+
{{#set: consumed by=RXN-8391}}
* HMDB : HMDB02307
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367]
+
* METABOLIGHTS : MTBLC57367
+
{{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}}
+
{{#set: common name=acryloyl-CoA}}
+
{{#set: molecular weight=817.551    }}
+
{{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}}
+
{{#set: reversible reaction associated=PPCOAOm|RXN-6383}}
+

Revision as of 15:58, 21 March 2018

Metabolite Delta4-hexadecenoyl-ACPs

  • common name:
    • a (4Z)-hexadec-4-enoyl-[acp]
  • Synonym(s):
    • a Δ4-hexadecenoyl-[acyl-carrier-protein]
    • a Δ4-hexadecenoyl-[acp]
    • a (4Z)-hexadecenoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (4Z)-hexadec-4-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a Δ4-hexadecenoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "a Δ4-hexadecenoyl-[acp" cannot be used as a page name in this wiki.
  • "a (4Z)-hexadecenoyl-[acp" cannot be used as a page name in this wiki.