Difference between revisions of "Tiso gene 14064"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-adenine-37 tRNA-adenine-37] == * common name: ** an adenine37 in tRNA * Synonym(s): == Re...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O | ||
* common name: | * common name: | ||
| − | ** | + | ** apo-4'-lycopenal |
| + | * inchi key: | ||
| + | ** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N | ||
| + | * molecular weight: | ||
| + | ** 482.748 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11999]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183] |
| + | {{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}} | ||
| + | {{#set: common name=apo-4'-lycopenal}} | ||
| + | {{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}} | ||
| + | {{#set: molecular weight=482.748 }} | ||
| + | {{#set: produced by=RXN-11999}} | ||
Revision as of 15:58, 21 March 2018
Contents
Metabolite CPD-12936
- smiles:
- CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
- common name:
- apo-4'-lycopenal
- inchi key:
- InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
- molecular weight:
- 482.748
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
