Difference between revisions of "CPD-173"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10089 RXN-10089] == * direction: ** LEFT-TO-RIGHT * common name: ** imidazole acetaldehyde redu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10089 RXN-10089] ==
−
* smiles:
+
* direction:
−
** CC(=O)C(C)(O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
+
 
* common name:
 
* common name:
−
** (S)-2-acetolactate
+
** imidazole acetaldehyde reductase
−
* molecular weight:
+
* ec number:
−
** 131.108   
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-2-hydroxy-2-methyl-3-oxobutanoate
 
−
** α-acetolactate
 
−
** (2S)-2-hydroxy-2-methyl-3-oxobutanoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-6081]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[IMIDAZOLE_ACETALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[4-IMIDAZOLEACETATE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
* [[ACETOLACTSYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 imidazole acetaldehyde[c] '''+''' 1 H2O[c] '''=>''' 1 4-imidazoleacetate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
−
* [[ACETOLACTREDUCTOISOM-RXN]]
+
 
−
* [[RXN-14037]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3513]]
 +
** Source: [[orthology-athaliana]]
 +
* Gene: [[Tiso_gene_7322]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6181]], histamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6181 PWY-6181]
 +
** '''2''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31059 31059]
−
* HMDB : HMDB06855
+
* LIGAND-RXN:
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R04065 R04065]
−
** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEMSPIDER:
+
{{#set: common name=imidazole acetaldehyde reductase}}
−
** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073]
+
{{#set: ec number=EC-1.2.1.3}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3513|Tiso_gene_7322}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476]
+
{{#set: in pathway=PWY-6181}}
−
* BIGG : alac__S
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(S)-2-acetolactate}}
+
−
{{#set: molecular weight=131.108    }}
+
−
{{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}}
+
−
{{#set: consumed by=RXN-6081}}
+
−
{{#set: produced by=ACETOLACTSYN-RXN}}
+
−
{{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN|RXN-14037}}
+

Revision as of 15:58, 21 March 2018

Reaction RXN-10089

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • imidazole acetaldehyde reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6181, histamine degradation: PWY-6181
    • 2 reactions found over 3 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-173&oldid=37789"