Difference between revisions of "Tiso gene 11786"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3))) |
* common name: | * common name: | ||
− | ** | + | ** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide |
+ | * inchi key: | ||
+ | ** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 826.095 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3,5,3'-triiodothyronine acyl β-D-glucuronide |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-10609]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330] |
− | + | {{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}} | |
− | + | {{#set: common name=3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide}} | |
− | + | {{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}} | |
− | + | {{#set: molecular weight=826.095 }} | |
− | {{#set: smiles=C | + | {{#set: common name=3,5,3'-triiodothyronine acyl β-D-glucuronide}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-10609}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: produced by= | + |
Revision as of 15:58, 21 March 2018
Contents
Metabolite CPD-11402
- smiles:
- C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
- common name:
- 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
- inchi key:
- InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
- molecular weight:
- 826.095
- Synonym(s):
- 3,5,3'-triiodothyronine acyl β-D-glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))" cannot be used as a page name in this wiki.