Difference between revisions of "RXN-11667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16953 CPD-16953] == * smiles: ** CC2(C(C(C)O)=NC1(C(=O)NC(N)=NC=1N2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_26 == * right end position: ** 46558 * transcription direction: ** POSITIVE * left end position: ** 42708 * centisome position: ** 86.16216...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_26 == |
| − | * | + | * right end position: |
| − | ** | + | ** 46558 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 42708 |
| − | * | + | * centisome position: |
| − | ** | + | ** 86.16216 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[2.4.1.119-RXN]] |
| − | + | ** Source: [[annotation-experimental_annotation]] | |
| − | == | + | *** Assignment: automated-name-match |
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=46558}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=42708}} |
| − | {{#set: | + | {{#set: centisome position=86.16216 }} |
| − | {{#set: | + | {{#set: reaction associated=2.4.1.119-RXN}} |
| − | {{#set: | + | {{#set: pathway associated=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS}} |
| − | {{#set: | + | |
Revision as of 15:58, 21 March 2018
Gene Tiso_gene_26
- right end position:
- 46558
- transcription direction:
- POSITIVE
- left end position:
- 42708
- centisome position:
- 86.16216
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.119-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-experimental_annotation
