Difference between revisions of "Trans-D2-decenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * smiles: ** CC(COP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_11176 == * right end position: ** 5331 * transcription direction: ** NEGATIVE * left end position: ** 4033 * centisome position: ** 50.6149...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] ==
+
== Gene Tiso_gene_11176 ==
−
* smiles:
+
* right end position:
−
** CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O
+
** 5331
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 3-hydroxyisovaleryl-CoA
+
** 4033
−
* molecular weight:
+
* centisome position:
−
** 863.619    
+
** 50.61496    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-hydroxy-isovaleryl-coa
 
−
** 3-hydroxy-iso-valeryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ANTHRANSYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14266]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[PABASYN-RXN]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 +
* [[PWY-5958]]
 +
* [[PWY-6543]]
 +
* [[PWY-6661]]
 +
* [[PWY-6660]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5331}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203667 25203667]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=4033}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62555 62555]
+
{{#set: centisome position=50.61496   }}
−
{{#set: smiles=CC(COP(=O)([O-])OP(=O)([O-])OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])([O-])=O))(C)C(C(NCCC(NCCSC(=O)CC(C)(C)O)=O)=O)O}}
+
{{#set: reaction associated=ANTHRANSYN-RXN|PABASYN-RXN}}
−
{{#set: inchi key=InChIKey=PEVZKILCBDEOBT-UHFFFAOYSA-J}}
+
{{#set: pathway associated=TRPSYN-PWY|PWY-5958|PWY-6543|PWY-6661|PWY-6660}}
−
{{#set: common name=3-hydroxyisovaleryl-CoA}}
+
−
{{#set: molecular weight=863.619   }}
+
−
{{#set: common name=3-hydroxy-isovaleryl-coa|3-hydroxy-iso-valeryl-CoA}}
+
−
{{#set: reversible reaction associated=RXN-14266}}
+

Revision as of 16:58, 21 March 2018

Gene Tiso_gene_11176

  • right end position:
    • 5331
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4033
  • centisome position:
    • 50.61496
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D2-decenoyl-ACPs&oldid=37796"