Difference between revisions of "RXN-10089"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-CMPD PELARGONIDIN-CMPD] == * smiles: ** C3(C(C2(=[O+]C1(C=C(C=C(C=1C=C2[O-])[O-])O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2141 RXN0-2141] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PELARGONIDIN-CMPD PELARGONIDIN-CMPD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2141 RXN0-2141] ==
−
* smiles:
+
* direction:
−
** C3(C(C2(=[O+]C1(C=C(C=C(C=1C=C2[O-])[O-])O)))=CC=C(C=3)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XVFMGWDSJLBXDZ-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** pelargonidin
+
** 3-oxoacyl-synthase
−
* molecular weight:
+
* ec number:
−
** 269.233   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** 3,5,7-Trihydroxy-2-(4-hydroxyphenil)-1-benzopyrylium chloride
 
−
** 3,4',5,7-tetrahydroxyflavylium chloride
 
−
** 3,5,7-trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride
 
−
** 1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride
 
−
** Flavylium, 3,4',5,7-tetrahydroxy-, chloride
 
−
** Pelargonidin chloride
 
−
** Pelargonidol chloride
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9724]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Cis-delta-3-decenoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[b-Keto-cis-D5-dodecenoyl-ACPs]][c]
−
* [[LEUCPEL-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a (3Z)-dec-3-enoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c] '''+''' 1 a (5Z)-3-oxo-dodec-5-enoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-862]], (5Z)-dodec-5-enoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-862 PWY0-862]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 134-04-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIPID_MAPS : LMPK12010003
+
{{#set: common name=3-oxoacyl-synthase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.41}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657848 90657848]
+
{{#set: gene associated=Tiso_gene_5939}}
−
* HMDB : HMDB03263
+
{{#set: in pathway=PWY0-862}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05904 C05904]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=25863 25863]
+
−
* METABOLIGHTS : MTBLC25863
+
−
{{#set: smiles=C3(C(C2(=[O+]C1(C=C(C=C(C=1C=C2[O-])[O-])O)))=CC=C(C=3)O)}}
+
−
{{#set: inchi key=InChIKey=XVFMGWDSJLBXDZ-UHFFFAOYSA-M}}
+
−
{{#set: common name=pelargonidin}}
+
−
{{#set: molecular weight=269.233    }}
+
−
{{#set: common name=3,5,7-Trihydroxy-2-(4-hydroxyphenil)-1-benzopyrylium chloride|3,4',5,7-tetrahydroxyflavylium chloride|3,5,7-trihydroxy-2-(4-hydroxyphenyl)benzopyrylium chloride|1-Benzopyrylium, 3,5,7-trihydroxy-2-(4-hydroxyphenyl)-, chloride|Flavylium, 3,4',5,7-tetrahydroxy-, chloride|Pelargonidin chloride|Pelargonidol chloride}}
+
−
{{#set: consumed by=RXN-9724}}
+
−
{{#set: produced by=LEUCPEL-RXN}}
+

Revision as of 15:58, 21 March 2018

Reaction RXN0-2141

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-862, (5Z)-dodec-5-enoate biosynthesis: PWY0-862
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10089&oldid=37801"