Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * inch...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == * common name: ** an L-cysteine-S-conju...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-Substituted-L-Cysteines S-Substituted-L-Cysteines] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-cysteine-S-conjugate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a cysteine-S-conjugate |
| + | ** an S-substituted-L-cysteine | ||
| + | ** an L-cysteine conjugate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-6642]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-13684]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-cysteine-S-conjugate}} | |
| − | + | {{#set: common name=a cysteine-S-conjugate|an S-substituted-L-cysteine|an L-cysteine conjugate}} | |
| − | + | {{#set: produced by=RXN-6642}} | |
| − | + | {{#set: reversible reaction associated=RXN-13684}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 15:59, 21 March 2018
Contents
Metabolite S-Substituted-L-Cysteines
- common name:
- an L-cysteine-S-conjugate
- Synonym(s):
- a cysteine-S-conjugate
- an S-substituted-L-cysteine
- an L-cysteine conjugate
