Difference between revisions of "CPD-511"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * common name: ** al...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
 
* common name:
 
* common name:
** glycerophosphodiester degradation
+
** aldehydo-D-ribose 5-phosphate
 +
* inchi key:
 +
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** keto-D-ribose 5-phosphate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''2''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[GLYCPDIESTER-RXN]]
+
* [[RXN-15346]]
** 2 associated gene(s):
+
* [[RXN-14997]]
*** [[Tiso_gene_17232]]
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_5334]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
* [[RXN-15745]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_15777]]
+
** 3 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
* ECOCYC:
+
* PUBCHEM:
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6952 PWY-6952]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: common name=glycerophosphodiester degradation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
{{#set: reaction found=2}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
{{#set: total reaction=2}}
+
{{#set: common name=aldehydo-D-ribose 5-phosphate}}
{{#set: completion rate=100.0}}
+
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=keto-D-ribose 5-phosphate}}
 +
{{#set: produced by=RXN-15346|RXN-14997}}

Revision as of 15:59, 21 March 2018

Metabolite CPD-15895

  • smiles:
    • [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
  • common name:
    • aldehydo-D-ribose 5-phosphate
  • inchi key:
    • InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • keto-D-ribose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.