Difference between revisions of "Tiso gene 2667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1353 CPD1G-1353] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(C(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1G-1353 CPD1G-1353] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))=O)C(O)CCCCCCCCCCCCCCCCCCCC3(CC(CCCCCCCCCCCCCCCCC(=O)C(CCCCCCCCCCCCCCCCCC)C)3) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trehalose-cis-keto-mono-mycolate |
+ | * inchi key: | ||
+ | ** InChIKey=WPVQFTORCFMMCP-WBSUMZSHSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1590.555 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN1G-1438]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657448 90657448] |
− | + | {{#set: smiles=CCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))=O)C(O)CCCCCCCCCCCCCCCCCCCC3(CC(CCCCCCCCCCCCCCCCC(=O)C(CCCCCCCCCCCCCCCCCC)C)3)}} | |
− | + | {{#set: common name=trehalose-cis-keto-mono-mycolate}} | |
− | + | {{#set: inchi key=InChIKey=WPVQFTORCFMMCP-WBSUMZSHSA-N}} | |
− | + | {{#set: molecular weight=1590.555 }} | |
− | + | {{#set: produced by=RXN1G-1438}} | |
− | + | ||
− | + | ||
− | {{#set: smiles= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:59, 21 March 2018
Contents
Metabolite CPD1G-1353
- smiles:
- CCCCCCCCCCCCCCCCCCCCCCCCC(C(OCC1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))=O)C(O)CCCCCCCCCCCCCCCCCCCC3(CC(CCCCCCCCCCCCCCCCC(=O)C(CCCCCCCCCCCCCCCCCC)C)3)
- common name:
- trehalose-cis-keto-mono-mycolate
- inchi key:
- InChIKey=WPVQFTORCFMMCP-WBSUMZSHSA-N
- molecular weight:
- 1590.555
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: