Difference between revisions of "Tiso gene 12932"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14030 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus * RXN-8443 ** pantogra...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] == * smiles: ** CC(=CC(=O)SCCNC(=O...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] == |
+ | * smiles: | ||
+ | ** CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-] | ||
+ | * common name: | ||
+ | ** 3-methylglutaconyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I | ||
+ | * molecular weight: | ||
+ | ** 888.606 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** trans-3-methylglutaconyl-CoA | ||
+ | ** (E)-3-methylglutaconyl-1-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[METHYLGLUTACONYL-COA-HYDRATASE-RXN]] | |
− | + | ||
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657229 90657229] |
+ | * HMDB : HMDB01057 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15488 15488] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03231 C03231] | ||
+ | {{#set: smiles=CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-]}} | ||
+ | {{#set: common name=3-methylglutaconyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I}} | ||
+ | {{#set: molecular weight=888.606 }} | ||
+ | {{#set: common name=trans-3-methylglutaconyl-CoA|(E)-3-methylglutaconyl-1-CoA}} | ||
+ | {{#set: produced by=METHYLCROTONYL-COA-CARBOXYLASE-RXN}} | ||
+ | {{#set: reversible reaction associated=METHYLGLUTACONYL-COA-HYDRATASE-RXN}} |
Revision as of 16:59, 21 March 2018
Contents
Metabolite TRANS-3-METHYL-GLUTACONYL-COA
- smiles:
- CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-]
- common name:
- 3-methylglutaconyl-CoA
- inchi key:
- InChIKey=GXKSHRDAHFLWPN-RKYLSHMCSA-I
- molecular weight:
- 888.606
- Synonym(s):
- trans-3-methylglutaconyl-CoA
- (E)-3-methylglutaconyl-1-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])CC(=O)[O-" cannot be used as a page name in this wiki.