Difference between revisions of "Tiso gene 14025"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6496 == * left end position: ** 2629 * transcription direction: ** POSITIVE * right end position: ** 3284 * centisome position: ** 21.68247...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6496 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] ==
−
* left end position:
+
* smiles:
−
** 2629
+
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 24-ethylidenelophenol
−
* right end position:
+
* inchi key:
−
** 3284
+
** InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
−
* centisome position:
+
* molecular weight:
−
** 21.682474    
+
** 426.724    
 
* Synonym(s):
 
* Synonym(s):
 +
** (Z)-24-ethylidenelophenol
 +
** citrostadienol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.224-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[2.1.1.143-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6558]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2629}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548595 9548595]
−
{{#set: right end position=3284}}
+
* CHEBI:
−
{{#set: centisome position=21.682474   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33203 33203]
−
{{#set: reaction associated=2.4.1.224-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-6558}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11523 C11523]
 +
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=24-ethylidenelophenol}}
 +
{{#set: inchi key=InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N}}
 +
{{#set: molecular weight=426.724   }}
 +
{{#set: common name=(Z)-24-ethylidenelophenol|citrostadienol}}
 +
{{#set: produced by=2.1.1.143-RXN}}

Revision as of 16:01, 21 March 2018

Metabolite CPD-4124

  • smiles:
    • CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 24-ethylidenelophenol
  • inchi key:
    • InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
  • molecular weight:
    • 426.724
  • Synonym(s):
    • (Z)-24-ethylidenelophenol
    • citrostadienol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14025&oldid=38064"