Difference between revisions of "Tiso gene 2450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_18184 == * left end position: ** 25 * transcription direction: ** POSITIVE * right end position: ** 3170 * centisome position: ** 0.783208...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] == * smiles: ** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_18184 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13227 CPD-13227] ==
−
* left end position:
+
* smiles:
−
** 25
+
** CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** N,N',N''-triacetylchitotriose
−
* right end position:
+
* inchi key:
−
** 3170
+
** InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N
−
* centisome position:
+
* molecular weight:
−
** 0.783208    
+
** 627.598    
 
* Synonym(s):
 
* Synonym(s):
 +
** triacetylchitotriose
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
+
* [[RXN-12626]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=25}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10930193 10930193]
−
{{#set: right end position=3170}}
+
* CHEMSPIDER:
−
{{#set: centisome position=0.783208   }}
+
** [http://www.chemspider.com/Chemical-Structure.392429.html 392429]
−
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71404 71404]
 +
{{#set: smiles=CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))}}
 +
{{#set: common name=N,N',N''-triacetylchitotriose}}
 +
{{#set: inchi key=InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N}}
 +
{{#set: molecular weight=627.598   }}
 +
{{#set: common name=triacetylchitotriose}}
 +
{{#set: consumed by=RXN-12626}}

Revision as of 16:01, 21 March 2018

Metabolite CPD-13227

  • smiles:
    • CC(=O)NC1(C(O)OC(CO)C(C(O)1)OC2(C(NC(C)=O)C(O)C(C(CO)O2)OC3(OC(C(O)C(O)C(NC(C)=O)3)CO)))
  • common name:
    • N,N',N-triacetylchitotriose
  • inchi key:
    • InChIKey=WZZVUHWLNMNWLW-MEWKLCDLSA-N
  • molecular weight:
    • 627.598
  • Synonym(s):
    • triacetylchitotriose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2450&oldid=38121"